C18H27N3O3 — CID 71888767
N-(4-acetylphenyl)-N'-[1-(dimethylamino)-4-methylpentan-2-yl]oxamide (PubChem CID 71888767) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-[1-(dimethylamino)-4-methylpentan-2-yl]oxamide.
| Compound Name | N-(4-acetylphenyl)-N'-[1-(dimethylamino)-4-methylpentan-2-yl]oxamide |
|---|---|
| PubChem CID | 71888767 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-(4-acetylphenyl)-N'-[1-(dimethylamino)-4-methylpentan-2-yl]oxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)NC(CC(C)C)CN(C)C)cc1 |
| InChI | InChI=1S/C18H27N3O3/c1-12(2)10-16(11-21(4)5)20-18(24)17(23)19-15-8-6-14(7-9-15)13(3)22/h6-9,12,16H,10-11H2,1-5H3,(H,19,23)(H,20,24) |
| InChIKey | LUJHYXFFMVEYDB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|