C21H32N4O3 — CID 71889123
N-cyclooctyl-N'-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]oxamide (PubChem CID 71889123) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-cyclooctyl-N'-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]oxamide.
| Compound Name | N-cyclooctyl-N'-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]oxamide |
|---|---|
| PubChem CID | 71889123 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-cyclooctyl-N'-[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]oxamide |
| SMILES | CC1CN(c2ccc(NC(=O)C(=O)NC3CCCCCCC3)cn2)CC(C)O1 |
| InChI | InChI=1S/C21H32N4O3/c1-15-13-25(14-16(2)28-15)19-11-10-18(12-22-19)24-21(27)20(26)23-17-8-6-4-3-5-7-9-17/h10-12,15-17H,3-9,13-14H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | UFSIUSAPQIUCOZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|