C22H32N2O4S — CID 71889427
4-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 71889427) has the molecular formula C22H32N2O4S and a molecular weight of 420.58 g/mol. Its IUPAC name is 4-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71889427 |
| Molecular Formula | C22H32N2O4S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | CC1CCN(C(=O)c2ccc(S(=O)(=O)NCC3CCCO3)cc2)C2CCCCC12 |
| InChI | InChI=1S/C22H32N2O4S/c1-16-12-13-24(21-7-3-2-6-20(16)21)22(25)17-8-10-19(11-9-17)29(26,27)23-15-18-5-4-14-28-18/h8-11,16,18,20-21,23H,2-7,12-15H2,1H3 |
| InChIKey | AEFSRUBFMVGIRF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |