C18H21FN2O3S — CID 71890029
5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-fluoro-N-[2-(4-methylphenoxy)ethyl]aniline (PubChem CID 71890029) has the molecular formula C18H21FN2O3S and a molecular weight of 364.44 g/mol. Its IUPAC name is 5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-fluoro-N-[2-(4-methylphenoxy)ethyl]aniline.
| Compound Name | 5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-fluoro-N-[2-(4-methylphenoxy)ethyl]aniline |
|---|---|
| PubChem CID | 71890029 |
| Molecular Formula | C18H21FN2O3S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-fluoro-N-[2-(4-methylphenoxy)ethyl]aniline |
| SMILES | Cc1ccc(OCCNc2cc(N3CCCS3(=O)=O)ccc2F)cc1 |
| InChI | InChI=1S/C18H21FN2O3S/c1-14-3-6-16(7-4-14)24-11-9-20-18-13-15(5-8-17(18)19)21-10-2-12-25(21,22)23/h3-8,13,20H,2,9-12H2,1H3 |
| InChIKey | AYMHMEYXMIHFOV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|