C18H18ClNO3S — CID 71891224
2-methoxyethyl 6-methyl-4-phenylthieno[2,3-b]pyridine-5-carboxylate;hydrochloride (PubChem CID 71891224) has the molecular formula C18H18ClNO3S and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-methoxyethyl 6-methyl-4-phenylthieno[2,3-b]pyridine-5-carboxylate;hydrochloride.
| Compound Name | 2-methoxyethyl 6-methyl-4-phenylthieno[2,3-b]pyridine-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 71891224 |
| Molecular Formula | C18H18ClNO3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-methoxyethyl 6-methyl-4-phenylthieno[2,3-b]pyridine-5-carboxylate;hydrochloride |
| SMILES | COCCOC(=O)c1c(C)nc2sccc2c1-c1ccccc1.Cl |
| InChI | InChI=1S/C18H17NO3S.ClH/c1-12-15(18(20)22-10-9-21-2)16(13-6-4-3-5-7-13)14-8-11-23-17(14)19-12;/h3-8,11H,9-10H2,1-2H3;1H |
| InChIKey | JVADGLILFNEWAK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|