C17H9F3N4OS — CID 71891755
N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzo[f]quinoline-5-carboxamide (PubChem CID 71891755) has the molecular formula C17H9F3N4OS and a molecular weight of 374.35 g/mol. Its IUPAC name is N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzo[f]quinoline-5-carboxamide.
| Compound Name | N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzo[f]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 71891755 |
| Molecular Formula | C17H9F3N4OS |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzo[f]quinoline-5-carboxamide |
| SMILES | O=C(Nc1nnc(C(F)(F)F)s1)c1cc2ccccc2c2cccnc12 |
| InChI | InChI=1S/C17H9F3N4OS/c18-17(19,20)15-23-24-16(26-15)22-14(25)12-8-9-4-1-2-5-10(9)11-6-3-7-21-13(11)12/h1-8H,(H,22,24,25) |
| InChIKey | CGDQZAZWPKWOIV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|