C27H30N4O2 — CID 71895394
1-(naphthalene-1-carbonyl)-N-(5-piperidin-1-yl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 71895394) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-(naphthalene-1-carbonyl)-N-(5-piperidin-1-yl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-(naphthalene-1-carbonyl)-N-(5-piperidin-1-yl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71895394 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-(naphthalene-1-carbonyl)-N-(5-piperidin-1-yl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cn1)C1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C27H30N4O2/c32-26(29-25-12-11-22(19-28-25)30-15-4-1-5-16-30)21-13-17-31(18-14-21)27(33)24-10-6-8-20-7-2-3-9-23(20)24/h2-3,6-12,19,21H,1,4-5,13-18H2,(H,28,29,32) |
| InChIKey | LQHCOQZGMABRCH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |