C20H18F2N2O4 — CID 71895897
4-benzoyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-1-carboxamide (PubChem CID 71895897) has the molecular formula C20H18F2N2O4 and a molecular weight of 388.37 g/mol. Its IUPAC name is 4-benzoyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-1-carboxamide.
| Compound Name | 4-benzoyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71895897 |
| Molecular Formula | C20H18F2N2O4 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-benzoyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-1-carboxamide |
| SMILES | O=C(c1ccccc1)C1CCN(C(=O)Nc2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C20H18F2N2O4/c21-20(22)27-16-7-6-15(12-17(16)28-20)23-19(26)24-10-8-14(9-11-24)18(25)13-4-2-1-3-5-13/h1-7,12,14H,8-11H2,(H,23,26) |
| InChIKey | FXPIGDLNEHIIQG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |