C16H19F3N4S — CID 71896580
N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 71896580) has the molecular formula C16H19F3N4S and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 71896580 |
| Molecular Formula | C16H19F3N4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(=NNc1ccc(C(F)(F)F)cn1)c1sc(C(C)(C)C)nc1C |
| InChI | InChI=1S/C16H19F3N4S/c1-9-13(24-14(21-9)15(3,4)5)10(2)22-23-12-7-6-11(8-20-12)16(17,18)19/h6-8H,1-5H3,(H,20,23) |
| InChIKey | HZZWUDVZMOHOSV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|