C12H21ClN4O2S — CID 71897359
N-[2-(azepan-1-yl)ethyl]-5-chloro-1-methylimidazole-4-sulfonamide (PubChem CID 71897359) has the molecular formula C12H21ClN4O2S and a molecular weight of 320.85 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-5-chloro-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-5-chloro-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 71897359 |
| Molecular Formula | C12H21ClN4O2S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-5-chloro-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCCN2CCCCCC2)c1Cl |
| InChI | InChI=1S/C12H21ClN4O2S/c1-16-10-14-12(11(16)13)20(18,19)15-6-9-17-7-4-2-3-5-8-17/h10,15H,2-9H2,1H3 |
| InChIKey | CXQIKMMBFUCQDR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |