C16H26N4OS — CID 71898124
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-3-methyl-1-(2-methylpiperidin-1-yl)butan-1-one (PubChem CID 71898124) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-3-methyl-1-(2-methylpiperidin-1-yl)butan-1-one.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-3-methyl-1-(2-methylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 71898124 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-3-methyl-1-(2-methylpiperidin-1-yl)butan-1-one |
| SMILES | Cc1cc(N)nc(SC(C(=O)N2CCCCC2C)C(C)C)n1 |
| InChI | InChI=1S/C16H26N4OS/c1-10(2)14(15(21)20-8-6-5-7-12(20)4)22-16-18-11(3)9-13(17)19-16/h9-10,12,14H,5-8H2,1-4H3,(H2,17,18,19) |
| InChIKey | HRXBBLCURJAPEA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |