C17H25N3OS — CID 71898287
[4-(pyrrolidine-1-carbonyl)phenyl]methyl N'-tert-butylcarbamimidothioate (PubChem CID 71898287) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is [4-(pyrrolidine-1-carbonyl)phenyl]methyl N'-tert-butylcarbamimidothioate.
| Compound Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl N'-tert-butylcarbamimidothioate |
|---|---|
| PubChem CID | 71898287 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl N'-tert-butylcarbamimidothioate |
| SMILES | CC(C)(C)/N=C(\N)SCc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H25N3OS/c1-17(2,3)19-16(18)22-12-13-6-8-14(9-7-13)15(21)20-10-4-5-11-20/h6-9H,4-5,10-12H2,1-3H3,(H2,18,19) |
| InChIKey | FQSVXIPRLJJNKN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|