C22H19FN2O3 — CID 71898468
3-[3-(3-fluoro-4-morpholin-4-ylphenyl)-3-oxoprop-1-enyl]-1H-quinolin-2-one (PubChem CID 71898468) has the molecular formula C22H19FN2O3 and a molecular weight of 378.40 g/mol. Its IUPAC name is 3-[3-(3-fluoro-4-morpholin-4-ylphenyl)-3-oxoprop-1-enyl]-1H-quinolin-2-one.
| Compound Name | 3-[3-(3-fluoro-4-morpholin-4-ylphenyl)-3-oxoprop-1-enyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 71898468 |
| Molecular Formula | C22H19FN2O3 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[3-(3-fluoro-4-morpholin-4-ylphenyl)-3-oxoprop-1-enyl]-1H-quinolin-2-one |
| SMILES | O=C(C=Cc1cc2ccccc2[nH]c1=O)c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C22H19FN2O3/c23-18-14-16(5-7-20(18)25-9-11-28-12-10-25)21(26)8-6-17-13-15-3-1-2-4-19(15)24-22(17)27/h1-8,13-14H,9-12H2,(H,24,27) |
| InChIKey | LMXYHYLQNZZIER-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|