C20H21FN2O3 — CID 71844078
3-(5-ethoxy-2-pyridinyl)-1-(3-fluoro-4-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 71844078) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is 3-(5-ethoxy-2-pyridinyl)-1-(3-fluoro-4-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | 3-(5-ethoxy-2-pyridinyl)-1-(3-fluoro-4-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71844078 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 3-(5-ethoxy-2-pyridinyl)-1-(3-fluoro-4-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C=CC(=O)c2ccc(N3CCOCC3)c(F)c2)nc1 |
| InChI | InChI=1S/C20H21FN2O3/c1-2-26-17-6-4-16(22-14-17)5-8-20(24)15-3-7-19(18(21)13-15)23-9-11-25-12-10-23/h3-8,13-14H,2,9-12H2,1H3 |
| InChIKey | NIZFJBNIGDUQFE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|