C22H24FNO — CID 71899779
N-[(4-fluorophenyl)-phenylmethyl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 71899779) has the molecular formula C22H24FNO and a molecular weight of 337.44 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-phenylmethyl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)-phenylmethyl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 71899779 |
| Molecular Formula | C22H24FNO |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(4-fluorophenyl)-phenylmethyl]-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CN(C(=O)C1CC2CCC1C2)C(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FNO/c1-24(22(25)20-14-15-7-8-18(20)13-15)21(16-5-3-2-4-6-16)17-9-11-19(23)12-10-17/h2-6,9-12,15,18,20-21H,7-8,13-14H2,1H3 |
| InChIKey | IYBCCUAWIHSZMS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |