C15H21ClN2O4S — CID 71900151
2-(4-chlorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)ethenesulfonamide (PubChem CID 71900151) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)ethenesulfonamide.
| Compound Name | 2-(4-chlorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)ethenesulfonamide |
|---|---|
| PubChem CID | 71900151 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)ethenesulfonamide |
| SMILES | O=S(=O)(C=Cc1ccc(Cl)cc1)NCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C15H21ClN2O4S/c16-14-3-1-13(2-4-14)5-10-23(20,21)17-11-15(19)12-18-6-8-22-9-7-18/h1-5,10,15,17,19H,6-9,11-12H2 |
| InChIKey | XGRFCIGTCXMCMT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |