C13H12F3NO3 — CID 71900564
(2-amino-2-oxoethyl) 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate (PubChem CID 71900564) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71900564 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
| SMILES | NC(=O)COC(=O)C1CC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO3/c14-13(15,16)10-4-2-1-3-7(10)8-5-9(8)12(19)20-6-11(17)18/h1-4,8-9H,5-6H2,(H2,17,18) |
| InChIKey | ROGGJDWNKIHUEO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |