C17H13BrF3NO2 — CID 75403174
(5-bromo-3-pyridinyl)methyl 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate (PubChem CID 75403174) has the molecular formula C17H13BrF3NO2 and a molecular weight of 400.19 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl)methyl 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate.
| Compound Name | (5-bromo-3-pyridinyl)methyl 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 75403174 |
| Molecular Formula | C17H13BrF3NO2 |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (5-bromo-3-pyridinyl)methyl 2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
| SMILES | O=C(OCc1cncc(Br)c1)C1CC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H13BrF3NO2/c18-11-5-10(7-22-8-11)9-24-16(23)14-6-13(14)12-3-1-2-4-15(12)17(19,20)21/h1-5,7-8,13-14H,6,9H2 |
| InChIKey | WFCLTFQLIGDJDS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |