C27H31N3O4S — CID 71902986
N-(2-phenoxyphenyl)-2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 71902986) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-(2-phenoxyphenyl)-2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(2-phenoxyphenyl)-2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 71902986 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-(2-phenoxyphenyl)-2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCN(CC(=O)Nc3ccccc3Oc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C27H31N3O4S/c1-20-17-21(2)27(22(3)18-20)35(32,33)30-15-13-29(14-16-30)19-26(31)28-24-11-7-8-12-25(24)34-23-9-5-4-6-10-23/h4-12,17-18H,13-16,19H2,1-3H3,(H,28,31) |
| InChIKey | RCSKFYXTFYVBTK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |