C25H34N4O3 — CID 78827991
2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-N-[2-(4-methylphenoxy)phenyl]acetamide (PubChem CID 78827991) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-N-[2-(4-methylphenoxy)phenyl]acetamide.
| Compound Name | 2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-N-[2-(4-methylphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 78827991 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-N-[2-(4-methylphenoxy)phenyl]acetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(CC(=O)Nc2ccccc2Oc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C25H34N4O3/c1-4-29(5-2)25(31)19-28-16-14-27(15-17-28)18-24(30)26-22-8-6-7-9-23(22)32-21-12-10-20(3)11-13-21/h6-13H,4-5,14-19H2,1-3H3,(H,26,30) |
| InChIKey | AZDWPCCHZNBLCR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |