C25H24N2O4S — CID 71904388
(3-methylbenzo[g][1]benzofuran-2-yl)-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 71904388) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is (3-methylbenzo[g][1]benzofuran-2-yl)-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-methylbenzo[g][1]benzofuran-2-yl)-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 71904388 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (3-methylbenzo[g][1]benzofuran-2-yl)-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3oc4c(ccc5ccccc54)c3C)CC2)cc1 |
| InChI | InChI=1S/C25H24N2O4S/c1-17-7-10-20(11-8-17)32(29,30)27-15-13-26(14-16-27)25(28)23-18(2)21-12-9-19-5-3-4-6-22(19)24(21)31-23/h3-12H,13-16H2,1-2H3 |
| InChIKey | AVKVFRLDSJKLOQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |