C19H25N3O3 — CID 71905949
1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)pyrrolidin-1-yl]-2-(2-phenoxyethoxy)ethanone (PubChem CID 71905949) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)pyrrolidin-1-yl]-2-(2-phenoxyethoxy)ethanone.
| Compound Name | 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)pyrrolidin-1-yl]-2-(2-phenoxyethoxy)ethanone |
|---|---|
| PubChem CID | 71905949 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)pyrrolidin-1-yl]-2-(2-phenoxyethoxy)ethanone |
| SMILES | Cc1n[nH]c(C)c1C1CCCN1C(=O)COCCOc1ccccc1 |
| InChI | InChI=1S/C19H25N3O3/c1-14-19(15(2)21-20-14)17-9-6-10-22(17)18(23)13-24-11-12-25-16-7-4-3-5-8-16/h3-5,7-8,17H,6,9-13H2,1-2H3,(H,20,21) |
| InChIKey | NKUWNXZCTPFKBA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|