C24H35N3O2 — CID 86769799
5-(2,5-dimethylphenoxy)-1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)azepan-1-yl]pentan-1-one (PubChem CID 86769799) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)azepan-1-yl]pentan-1-one.
| Compound Name | 5-(2,5-dimethylphenoxy)-1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)azepan-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 86769799 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)azepan-1-yl]pentan-1-one |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)N2CCCCCC2c2c(C)n[nH]c2C)c1 |
| InChI | InChI=1S/C24H35N3O2/c1-17-12-13-18(2)22(16-17)29-15-9-7-11-23(28)27-14-8-5-6-10-21(27)24-19(3)25-26-20(24)4/h12-13,16,21H,5-11,14-15H2,1-4H3,(H,25,26) |
| InChIKey | YUPSUVHOGAMPNH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|