C16H12BrCl2N3O3 — CID 71906365
N-(5-bromo-3-chloro-2-hydroxyphenyl)-4-chloro-3-(2-oxoimidazolidin-1-yl)benzamide (PubChem CID 71906365) has the molecular formula C16H12BrCl2N3O3 and a molecular weight of 445.10 g/mol. Its IUPAC name is N-(5-bromo-3-chloro-2-hydroxyphenyl)-4-chloro-3-(2-oxoimidazolidin-1-yl)benzamide.
| Compound Name | N-(5-bromo-3-chloro-2-hydroxyphenyl)-4-chloro-3-(2-oxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 71906365 |
| Molecular Formula | C16H12BrCl2N3O3 |
| Molecular Weight | 445.10 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | N-(5-bromo-3-chloro-2-hydroxyphenyl)-4-chloro-3-(2-oxoimidazolidin-1-yl)benzamide |
| SMILES | O=C(Nc1cc(Br)cc(Cl)c1O)c1ccc(Cl)c(N2CCNC2=O)c1 |
| InChI | InChI=1S/C16H12BrCl2N3O3/c17-9-6-11(19)14(23)12(7-9)21-15(24)8-1-2-10(18)13(5-8)22-4-3-20-16(22)25/h1-2,5-7,23H,3-4H2,(H,20,25)(H,21,24) |
| InChIKey | IVAQXVACXWHDDL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.10 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|