C18H29NO5S — CID 71906741
1-(4-methoxyphenyl)-1-[1-(2-propan-2-yloxyethylsulfonyl)pyrrolidin-2-yl]ethanol (PubChem CID 71906741) has the molecular formula C18H29NO5S and a molecular weight of 371.50 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1-[1-(2-propan-2-yloxyethylsulfonyl)pyrrolidin-2-yl]ethanol.
| Compound Name | 1-(4-methoxyphenyl)-1-[1-(2-propan-2-yloxyethylsulfonyl)pyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 71906741 |
| Molecular Formula | C18H29NO5S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-1-[1-(2-propan-2-yloxyethylsulfonyl)pyrrolidin-2-yl]ethanol |
| SMILES | COc1ccc(C(C)(O)C2CCCN2S(=O)(=O)CCOC(C)C)cc1 |
| InChI | InChI=1S/C18H29NO5S/c1-14(2)24-12-13-25(21,22)19-11-5-6-17(19)18(3,20)15-7-9-16(23-4)10-8-15/h7-10,14,17,20H,5-6,11-13H2,1-4H3 |
| InChIKey | JZORLFBONGUKJF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |