C17H19FN2O3S — CID 71907091
ethyl 4-[[2-(2-fluorophenyl)-1,3-thiazole-5-carbonyl]amino]pentanoate (PubChem CID 71907091) has the molecular formula C17H19FN2O3S and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 4-[[2-(2-fluorophenyl)-1,3-thiazole-5-carbonyl]amino]pentanoate.
| Compound Name | ethyl 4-[[2-(2-fluorophenyl)-1,3-thiazole-5-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 71907091 |
| Molecular Formula | C17H19FN2O3S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | ethyl 4-[[2-(2-fluorophenyl)-1,3-thiazole-5-carbonyl]amino]pentanoate |
| SMILES | CCOC(=O)CCC(C)NC(=O)c1cnc(-c2ccccc2F)s1 |
| InChI | InChI=1S/C17H19FN2O3S/c1-3-23-15(21)9-8-11(2)20-16(22)14-10-19-17(24-14)12-6-4-5-7-13(12)18/h4-7,10-11H,3,8-9H2,1-2H3,(H,20,22) |
| InChIKey | PWBQCUWWDIZHSU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |