C17H23N3O4 — CID 71907585
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(5-ethyl-3-methyl-1,2-oxazol-4-yl)propanamide (PubChem CID 71907585) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(5-ethyl-3-methyl-1,2-oxazol-4-yl)propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(5-ethyl-3-methyl-1,2-oxazol-4-yl)propanamide |
|---|---|
| PubChem CID | 71907585 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(5-ethyl-3-methyl-1,2-oxazol-4-yl)propanamide |
| SMILES | CCc1onc(C)c1NC(=O)CCN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C17H23N3O4/c1-3-13-15(10(2)19-24-13)18-14(21)8-9-20-16(22)11-6-4-5-7-12(11)17(20)23/h11-12H,3-9H2,1-2H3,(H,18,21) |
| InChIKey | WCTUUKOMZIGTRM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|