C23H26N4O3S — CID 98347908
3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]propanamide (PubChem CID 98347908) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]propanamide |
|---|---|
| PubChem CID | 98347908 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]propanamide |
| SMILES | Cc1cc(C)nc(Sc2ccc(NC(=O)CCN3C(=O)[C@H]4CCCC[C@H]4C3=O)cc2)n1 |
| InChI | InChI=1S/C23H26N4O3S/c1-14-13-15(2)25-23(24-14)31-17-9-7-16(8-10-17)26-20(28)11-12-27-21(29)18-5-3-4-6-19(18)22(27)30/h7-10,13,18-19H,3-6,11-12H2,1-2H3,(H,26,28)/t18-,19+ |
| InChIKey | FXOUMHODGVXUAV-KDURUIRLSA-N |
| XLogP | 3.75 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|