C19H28N2O4S — CID 71907693
4-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 71907693) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 4-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 4-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71907693 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)N2CC=C(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O4S/c1-19(2,3)16-9-12-21(13-10-16)18(22)15-5-7-17(8-6-15)26(23,24)20-11-14-25-4/h5-9,20H,10-14H2,1-4H3 |
| InChIKey | BGBLYOJGERLOKX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|