C24H29N3O4 — CID 71908285
2-[4-[[2-(2,5-dimethyl-1,3-oxazol-4-yl)ethylamino]methyl]-2-ethoxyphenoxy]-N-phenylacetamide (PubChem CID 71908285) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[4-[[2-(2,5-dimethyl-1,3-oxazol-4-yl)ethylamino]methyl]-2-ethoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[[2-(2,5-dimethyl-1,3-oxazol-4-yl)ethylamino]methyl]-2-ethoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 71908285 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 2-[4-[[2-(2,5-dimethyl-1,3-oxazol-4-yl)ethylamino]methyl]-2-ethoxyphenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(CNCCc2nc(C)oc2C)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H29N3O4/c1-4-29-23-14-19(15-25-13-12-21-17(2)31-18(3)26-21)10-11-22(23)30-16-24(28)27-20-8-6-5-7-9-20/h5-11,14,25H,4,12-13,15-16H2,1-3H3,(H,27,28) |
| InChIKey | FUTWILJCFYFPKB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|