C16H20N2O3 — CID 71910950
methyl N-[2-[(1-cyclopropylcyclopropyl)methylcarbamoyl]phenyl]carbamate (PubChem CID 71910950) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is methyl N-[2-[(1-cyclopropylcyclopropyl)methylcarbamoyl]phenyl]carbamate.
| Compound Name | methyl N-[2-[(1-cyclopropylcyclopropyl)methylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 71910950 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | methyl N-[2-[(1-cyclopropylcyclopropyl)methylcarbamoyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccccc1C(=O)NCC1(C2CC2)CC1 |
| InChI | InChI=1S/C16H20N2O3/c1-21-15(20)18-13-5-3-2-4-12(13)14(19)17-10-16(8-9-16)11-6-7-11/h2-5,11H,6-10H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | SXFDERJAWBHOQI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |