C18H19N3O4 — CID 56789409
methyl N-[2-[[3-(propanoylamino)phenyl]carbamoyl]phenyl]carbamate (PubChem CID 56789409) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is methyl N-[2-[[3-(propanoylamino)phenyl]carbamoyl]phenyl]carbamate.
| Compound Name | methyl N-[2-[[3-(propanoylamino)phenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 56789409 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | methyl N-[2-[[3-(propanoylamino)phenyl]carbamoyl]phenyl]carbamate |
| SMILES | CCC(=O)Nc1cccc(NC(=O)c2ccccc2NC(=O)OC)c1 |
| InChI | InChI=1S/C18H19N3O4/c1-3-16(22)19-12-7-6-8-13(11-12)20-17(23)14-9-4-5-10-15(14)21-18(24)25-2/h4-11H,3H2,1-2H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | ZJXUSQOECRJQEZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |