C18H28N2O5 — CID 71912014
tert-butyl N-[2-[(2-hydroxy-5-methoxyphenyl)carbamoyl]-2-methylbutyl]carbamate (PubChem CID 71912014) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-hydroxy-5-methoxyphenyl)carbamoyl]-2-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-hydroxy-5-methoxyphenyl)carbamoyl]-2-methylbutyl]carbamate |
|---|---|
| PubChem CID | 71912014 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | tert-butyl N-[2-[(2-hydroxy-5-methoxyphenyl)carbamoyl]-2-methylbutyl]carbamate |
| SMILES | CCC(C)(CNC(=O)OC(C)(C)C)C(=O)Nc1cc(OC)ccc1O |
| InChI | InChI=1S/C18H28N2O5/c1-7-18(5,11-19-16(23)25-17(2,3)4)15(22)20-13-10-12(24-6)8-9-14(13)21/h8-10,21H,7,11H2,1-6H3,(H,19,23)(H,20,22) |
| InChIKey | JCNNMLFSPRXIGV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|