C19H29N3O4S — CID 71912712
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(2-methyl-4-morpholin-4-ylphenyl)butanamide (PubChem CID 71912712) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(2-methyl-4-morpholin-4-ylphenyl)butanamide.
| Compound Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(2-methyl-4-morpholin-4-ylphenyl)butanamide |
|---|---|
| PubChem CID | 71912712 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(2-methyl-4-morpholin-4-ylphenyl)butanamide |
| SMILES | Cc1cc(N2CCOCC2)ccc1NC(=O)C(C(C)C)N1CCCS1(=O)=O |
| InChI | InChI=1S/C19H29N3O4S/c1-14(2)18(22-7-4-12-27(22,24)25)19(23)20-17-6-5-16(13-15(17)3)21-8-10-26-11-9-21/h5-6,13-14,18H,4,7-12H2,1-3H3,(H,20,23) |
| InChIKey | ZHOYKARVCIHJSM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|