C12H8ClN5O3 — CID 71914269
2-(4-chlorophenyl)-5-[(5-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole (PubChem CID 71914269) has the molecular formula C12H8ClN5O3 and a molecular weight of 305.68 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-[(5-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-chlorophenyl)-5-[(5-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 71914269 |
| Molecular Formula | C12H8ClN5O3 |
| Molecular Weight | 305.68 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-(4-chlorophenyl)-5-[(5-nitropyrazol-1-yl)methyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccnn1Cc1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C12H8ClN5O3/c13-9-3-1-8(2-4-9)12-16-15-10(21-12)7-17-11(18(19)20)5-6-14-17/h1-6H,7H2 |
| InChIKey | LGEJHXWFVKXVMX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|