C19H17Cl2N5O3 — CID 71914401
N'-(4,5-dichloro-6-methylpyridine-3-carbonyl)-4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide (PubChem CID 71914401) has the molecular formula C19H17Cl2N5O3 and a molecular weight of 434.28 g/mol. Its IUPAC name is N'-(4,5-dichloro-6-methylpyridine-3-carbonyl)-4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide.
| Compound Name | N'-(4,5-dichloro-6-methylpyridine-3-carbonyl)-4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 71914401 |
| Molecular Formula | C19H17Cl2N5O3 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N'-(4,5-dichloro-6-methylpyridine-3-carbonyl)-4-oxo-3-propan-2-ylphthalazine-1-carbohydrazide |
| SMILES | Cc1ncc(C(=O)NNC(=O)c2nn(C(C)C)c(=O)c3ccccc23)c(Cl)c1Cl |
| InChI | InChI=1S/C19H17Cl2N5O3/c1-9(2)26-19(29)12-7-5-4-6-11(12)16(25-26)18(28)24-23-17(27)13-8-22-10(3)14(20)15(13)21/h4-9H,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | MTIGIUDUPBNNHT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|