C17H25N6O2S+ — CID 8747223
dimethyl-[2-[[(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)amino]carbamothioylamino]ethyl]azanium (PubChem CID 8747223) has the molecular formula C17H25N6O2S+ and a molecular weight of 377.49 g/mol. Its IUPAC name is dimethyl-[2-[[(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)amino]carbamothioylamino]ethyl]azanium.
| Compound Name | dimethyl-[2-[[(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)amino]carbamothioylamino]ethyl]azanium |
|---|---|
| PubChem CID | 8747223 |
| Molecular Formula | C17H25N6O2S+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | dimethyl-[2-[[(4-oxo-3-propan-2-ylphthalazine-1-carbonyl)amino]carbamothioylamino]ethyl]azanium |
| SMILES | CC(C)n1nc(C(=O)NNC(=S)NCC[NH+](C)C)c2ccccc2c1=O |
| InChI | InChI=1S/C17H24N6O2S/c1-11(2)23-16(25)13-8-6-5-7-12(13)14(21-23)15(24)19-20-17(26)18-9-10-22(3)4/h5-8,11H,9-10H2,1-4H3,(H,19,24)(H2,18,20,26)/p+1 |
| InChIKey | GLVULAFCMUUTBI-UHFFFAOYSA-O |
| XLogP | -0.77 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|