C17H17N3O4 — CID 71914587
3-methyl-N-(2-morpholin-4-yl-1,3-benzoxazol-6-yl)furan-2-carboxamide (PubChem CID 71914587) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 3-methyl-N-(2-morpholin-4-yl-1,3-benzoxazol-6-yl)furan-2-carboxamide.
| Compound Name | 3-methyl-N-(2-morpholin-4-yl-1,3-benzoxazol-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 71914587 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 3-methyl-N-(2-morpholin-4-yl-1,3-benzoxazol-6-yl)furan-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1ccc2nc(N3CCOCC3)oc2c1 |
| InChI | InChI=1S/C17H17N3O4/c1-11-4-7-23-15(11)16(21)18-12-2-3-13-14(10-12)24-17(19-13)20-5-8-22-9-6-20/h2-4,7,10H,5-6,8-9H2,1H3,(H,18,21) |
| InChIKey | NYPBOBRGPRPRDV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |