C15H16N4O3 — CID 71914873
N-cyclopropyl-5-methyl-N-[(3-nitrophenyl)methyl]-1H-pyrazole-3-carboxamide (PubChem CID 71914873) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-cyclopropyl-5-methyl-N-[(3-nitrophenyl)methyl]-1H-pyrazole-3-carboxamide.
| Compound Name | N-cyclopropyl-5-methyl-N-[(3-nitrophenyl)methyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71914873 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-cyclopropyl-5-methyl-N-[(3-nitrophenyl)methyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(Cc2cccc([N+](=O)[O-])c2)C2CC2)n[nH]1 |
| InChI | InChI=1S/C15H16N4O3/c1-10-7-14(17-16-10)15(20)18(12-5-6-12)9-11-3-2-4-13(8-11)19(21)22/h2-4,7-8,12H,5-6,9H2,1H3,(H,16,17) |
| InChIKey | ZVXWBZVCPPCGRS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|