C23H30N2O5S — CID 71914932
tert-butyl (2S)-2-[[4-(tert-butylsulfamoyl)benzoyl]amino]-2-phenylacetate (PubChem CID 71914932) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[4-(tert-butylsulfamoyl)benzoyl]amino]-2-phenylacetate.
| Compound Name | tert-butyl (2S)-2-[[4-(tert-butylsulfamoyl)benzoyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 71914932 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | tert-butyl (2S)-2-[[4-(tert-butylsulfamoyl)benzoyl]amino]-2-phenylacetate |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C(=O)OC(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H30N2O5S/c1-22(2,3)25-31(28,29)18-14-12-17(13-15-18)20(26)24-19(16-10-8-7-9-11-16)21(27)30-23(4,5)6/h7-15,19,25H,1-6H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | GJDPJVMZPQAPOZ-IBGZPJMESA-N |
| XLogP | 3.58 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |