C13H17F2NO4S — CID 80999965
tert-butyl (2R)-2-(difluoromethylsulfonylamino)-2-phenylacetate (PubChem CID 80999965) has the molecular formula C13H17F2NO4S and a molecular weight of 321.35 g/mol. Its IUPAC name is tert-butyl (2R)-2-(difluoromethylsulfonylamino)-2-phenylacetate.
| Compound Name | tert-butyl (2R)-2-(difluoromethylsulfonylamino)-2-phenylacetate |
|---|---|
| PubChem CID | 80999965 |
| Molecular Formula | C13H17F2NO4S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | tert-butyl (2R)-2-(difluoromethylsulfonylamino)-2-phenylacetate |
| SMILES | CC(C)(C)OC(=O)[C@H](NS(=O)(=O)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H17F2NO4S/c1-13(2,3)20-11(17)10(9-7-5-4-6-8-9)16-21(18,19)12(14)15/h4-8,10,12,16H,1-3H3/t10-/m1/s1 |
| InChIKey | NXVSJOXWCIQMKE-SNVBAGLBSA-N |
| XLogP | 2.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |