C19H28N2O4 — CID 71917753
3-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)urea (PubChem CID 71917753) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 3-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 3-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 71917753 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-1-(furan-2-ylmethyl)-1-(oxolan-2-ylmethyl)urea |
| SMILES | O=C(NC1CCCC2OCCC12)N(Cc1ccco1)CC1CCCO1 |
| InChI | InChI=1S/C19H28N2O4/c22-19(20-17-6-1-7-18-16(17)8-11-25-18)21(12-14-4-2-9-23-14)13-15-5-3-10-24-15/h2,4,9,15-18H,1,3,5-8,10-13H2,(H,20,22) |
| InChIKey | DYBYQRRMVNQNHY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |