C15H17BrN2O2 — CID 71918952
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]cyclopentene-1-carboxamide (PubChem CID 71918952) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]cyclopentene-1-carboxamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]cyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 71918952 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]cyclopentene-1-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)C1=CCCC1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-10-8-12(16)6-7-13(10)18-14(19)9-17-15(20)11-4-2-3-5-11/h4,6-8H,2-3,5,9H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | KJSBUXVBPAWPGD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |