About 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea
1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea (PubChem CID 71919619) has the molecular formula C17H19F2N3O
and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea.
Molecular Properties
| Compound Name | 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea |
| PubChem CID | 71919619 |
| Molecular Formula | C17H19F2N3O |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea |
| SMILES | CC(NC(=O)N(Cc1ccccc1)CC(F)F)c1ccncc1 |
| InChI | InChI=1S/C17H19F2N3O/c1-13(15-7-9-20-10-8-15)21-17(23)22(12-16(18)19)11-14-5-3-2-4-6-14/h2-10,13,16H,11-12H2,1H3,(H,21,23) |
| InChIKey | YARWNZUQUFWRRT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea?
The IUPAC name of 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea (CID 71919619) is 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea.
What is the SMILES notation for 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea?
The canonical SMILES for 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea is CC(NC(=O)N(Cc1ccccc1)CC(F)F)c1ccncc1.
What is the InChIKey of 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea?
The InChIKey is YARWNZUQUFWRRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2N3O/c1-13(15-7-9-20-10-8-15)21-17(23)22(12-16(18)19)11-14-5-3-2-4-6-14/h2-10,13,16H,11-12H2,1H3,(H,21,23).
What are the key properties of 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea?
1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea has a molecular weight of 319.36 g/mol, XLogP of 3.62, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1-(2,2-difluoroethyl)-3-(1-pyridin-4-ylethyl)urea is sourced from PubChem (CID 71919619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).