C21H24F2N2O3 — CID 122027679
4-[[benzyl(2,2-difluoroethyl)carbamoyl]amino]-5-phenylpentanoic acid (PubChem CID 122027679) has the molecular formula C21H24F2N2O3 and a molecular weight of 390.43 g/mol. Its IUPAC name is 4-[[benzyl(2,2-difluoroethyl)carbamoyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[benzyl(2,2-difluoroethyl)carbamoyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122027679 |
| Molecular Formula | C21H24F2N2O3 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-[[benzyl(2,2-difluoroethyl)carbamoyl]amino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)N(Cc1ccccc1)CC(F)F |
| InChI | InChI=1S/C21H24F2N2O3/c22-19(23)15-25(14-17-9-5-2-6-10-17)21(28)24-18(11-12-20(26)27)13-16-7-3-1-4-8-16/h1-10,18-19H,11-15H2,(H,24,28)(H,26,27) |
| InChIKey | OIMLZIIFVMLNQX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |