C13H17ClN2O3S — CID 71920586
N-(3-chloro-4-methoxyphenyl)-4-cyano-N-methylbutane-1-sulfonamide (PubChem CID 71920586) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-cyano-N-methylbutane-1-sulfonamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-cyano-N-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 71920586 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-cyano-N-methylbutane-1-sulfonamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)CCCCC#N)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O3S/c1-16(20(17,18)9-5-3-4-8-15)11-6-7-13(19-2)12(14)10-11/h6-7,10H,3-5,9H2,1-2H3 |
| InChIKey | FXBUMPVNYRMYTN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|