C18H26N4O — CID 71920717
1-cyclohex-2-en-1-yl-3-[2-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 71920717) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-3-[2-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-cyclohex-2-en-1-yl-3-[2-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 71920717 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-3-[2-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | CN1CCN(c2ccccc2NC(=O)NC2C=CCCC2)CC1 |
| InChI | InChI=1S/C18H26N4O/c1-21-11-13-22(14-12-21)17-10-6-5-9-16(17)20-18(23)19-15-7-3-2-4-8-15/h3,5-7,9-10,15H,2,4,8,11-14H2,1H3,(H2,19,20,23) |
| InChIKey | FWYPAOGATGVKNX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|