C19H26N4O — CID 71920840
1-[(1-benzylcyclobutyl)methyl]-3-[2-(1-methylpyrazol-4-yl)ethyl]urea (PubChem CID 71920840) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[(1-benzylcyclobutyl)methyl]-3-[2-(1-methylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[(1-benzylcyclobutyl)methyl]-3-[2-(1-methylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 71920840 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1-[(1-benzylcyclobutyl)methyl]-3-[2-(1-methylpyrazol-4-yl)ethyl]urea |
| SMILES | Cn1cc(CCNC(=O)NCC2(Cc3ccccc3)CCC2)cn1 |
| InChI | InChI=1S/C19H26N4O/c1-23-14-17(13-22-23)8-11-20-18(24)21-15-19(9-5-10-19)12-16-6-3-2-4-7-16/h2-4,6-7,13-14H,5,8-12,15H2,1H3,(H2,20,21,24) |
| InChIKey | UKTLJPDJYIONDL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |