C13H20N4O3 — CID 80689093
1-[2-(1-methylpyrazol-4-yl)ethylcarbamoylamino]cyclopentane-1-carboxylic acid (PubChem CID 80689093) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-[2-(1-methylpyrazol-4-yl)ethylcarbamoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-(1-methylpyrazol-4-yl)ethylcarbamoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 80689093 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-[2-(1-methylpyrazol-4-yl)ethylcarbamoylamino]cyclopentane-1-carboxylic acid |
| SMILES | Cn1cc(CCNC(=O)NC2(C(=O)O)CCCC2)cn1 |
| InChI | InChI=1S/C13H20N4O3/c1-17-9-10(8-15-17)4-7-14-12(20)16-13(11(18)19)5-2-3-6-13/h8-9H,2-7H2,1H3,(H,18,19)(H2,14,16,20) |
| InChIKey | MWZQGGHNEZKJFL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |