About 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol
1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 71922623) has the molecular formula C15H18N2O2S
and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 71922623 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | COCc1nc(CNC2c3ccccc3CC2O)cs1 |
| InChI | InChI=1S/C15H18N2O2S/c1-19-8-14-17-11(9-20-14)7-16-15-12-5-3-2-4-10(12)6-13(15)18/h2-5,9,13,15-16,18H,6-8H2,1H3 |
| InChIKey | VCNBSNKEISOIBR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol (CID 71922623) is 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol is COCc1nc(CNC2c3ccccc3CC2O)cs1.
What is the InChIKey of 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol?
The InChIKey is VCNBSNKEISOIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S/c1-19-8-14-17-11(9-20-14)7-16-15-12-5-3-2-4-10(12)6-13(15)18/h2-5,9,13,15-16,18H,6-8H2,1H3.
What are the key properties of 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol?
1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol has a molecular weight of 290.39 g/mol, XLogP of 2.04, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(methoxymethyl)-1,3-thiazol-4-yl]methylamino]-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 71922623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).